C20H20N4OS — CID 23820633
3-(3-methylsulfanylphenyl)-1,1-bis(pyridin-2-ylmethyl)urea (PubChem CID 23820633) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-(3-methylsulfanylphenyl)-1,1-bis(pyridin-2-ylmethyl)urea.
| Compound Name | 3-(3-methylsulfanylphenyl)-1,1-bis(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 23820633 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-(3-methylsulfanylphenyl)-1,1-bis(pyridin-2-ylmethyl)urea |
| SMILES | CSc1cccc(NC(=O)N(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C20H20N4OS/c1-26-19-10-6-9-16(13-19)23-20(25)24(14-17-7-2-4-11-21-17)15-18-8-3-5-12-22-18/h2-13H,14-15H2,1H3,(H,23,25) |
| InChIKey | CGCWIYGPXKZVFL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |