C23H25N3O — CID 121084600
3-(3,5-dimethylphenyl)-1-(2-phenylethyl)-1-(pyridin-2-ylmethyl)urea (PubChem CID 121084600) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-(2-phenylethyl)-1-(pyridin-2-ylmethyl)urea.
| Compound Name | 3-(3,5-dimethylphenyl)-1-(2-phenylethyl)-1-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 121084600 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-(2-phenylethyl)-1-(pyridin-2-ylmethyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)N(CCc2ccccc2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C23H25N3O/c1-18-14-19(2)16-22(15-18)25-23(27)26(17-21-10-6-7-12-24-21)13-11-20-8-4-3-5-9-20/h3-10,12,14-16H,11,13,17H2,1-2H3,(H,25,27) |
| InChIKey | QSULAXWDTVSEOB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |