C38H44N2 — CID 102242944
1-N,2-N-bis[4-methyl-2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine (PubChem CID 102242944) has the molecular formula C38H44N2 and a molecular weight of 528.78 g/mol. Its IUPAC name is 1-N,2-N-bis[4-methyl-2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis[4-methyl-2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 102242944 |
| Molecular Formula | C38H44N2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 1-N,2-N-bis[4-methyl-2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine |
| SMILES | Cc1cc(C(C)C)c(/N=C2C(=N/c3c(C(C)C)cc(C)cc3C(C)C)/c3cccc4cccc/2c34)c(C(C)C)c1 |
| InChI | InChI=1S/C38H44N2/c1-21(2)30-17-25(9)18-31(22(3)4)35(30)39-37-28-15-11-13-27-14-12-16-29(34(27)28)38(37)40-36-32(23(5)6)19-26(10)20-33(36)24(7)8/h11-24H,1-10H3/b39-37+,40-38+ |
| InChIKey | MUTRKAVZLQPYRH-HVMBLDELSA-N |
| XLogP | 11.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|