C55H42F4N2 — CID 122401623
2-N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-1-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 122401623) has the molecular formula C55H42F4N2 and a molecular weight of 806.95 g/mol. Its IUPAC name is 2-N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-1-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 2-N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-1-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 122401623 |
| Molecular Formula | C55H42F4N2 |
| Molecular Weight | 806.95 g/mol |
| Exact Mass | 806.33 |
| IUPAC Name | 2-N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-1-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | CCc1cccc(CC)c1/N=C1C(=N/c2c(C(c3ccc(F)cc3)c3ccc(F)cc3)cc(C)cc2C(c2ccc(F)cc2)c2ccc(F)cc2)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C55H42F4N2/c1-4-34-9-6-10-35(5-2)52(34)60-54-45-13-7-11-36-12-8-14-46(51(36)45)55(54)61-53-47(49(37-15-23-41(56)24-16-37)38-17-25-42(57)26-18-38)31-33(3)32-48(53)50(39-19-27-43(58)28-20-39)40-21-29-44(59)30-22-40/h6-32,49-50H,4-5H2,1-3H3/b60-54+,61-55+ |
| InChIKey | DFNYPSYHGFEJFJ-LBMNZFSISA-N |
| XLogP | 14.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.95 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|