C50H41F4N3 — CID 102293526
1-[6-[N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,6-dimethylphenyl)ethanimine (PubChem CID 102293526) has the molecular formula C50H41F4N3 and a molecular weight of 759.89 g/mol. Its IUPAC name is 1-[6-[N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,6-dimethylphenyl)ethanimine.
| Compound Name | 1-[6-[N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,6-dimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 102293526 |
| Molecular Formula | C50H41F4N3 |
| Molecular Weight | 759.89 g/mol |
| Exact Mass | 759.32 |
| IUPAC Name | 1-[6-[N-[2,6-bis[bis(4-fluorophenyl)methyl]-4-methylphenyl]-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,6-dimethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)cccc1C)c1cccc(/C(C)=N/c2c(C(c3ccc(F)cc3)c3ccc(F)cc3)cc(C)cc2C(c2ccc(F)cc2)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C50H41F4N3/c1-30-28-43(47(35-12-20-39(51)21-13-35)36-14-22-40(52)23-15-36)50(44(29-30)48(37-16-24-41(53)25-17-37)38-18-26-42(54)27-19-38)56-34(5)46-11-7-10-45(57-46)33(4)55-49-31(2)8-6-9-32(49)3/h6-29,47-48H,1-5H3/b55-33+,56-34+ |
| InChIKey | VMSVRIWKPMUQLP-JPCJTSISSA-N |
| XLogP | 13.21 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.89 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|