C43H36F2N2 — CID 122229833
1-N-[2-[bis(4-fluorophenyl)methyl]-4,6-dimethylphenyl]-2-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 122229833) has the molecular formula C43H36F2N2 and a molecular weight of 618.77 g/mol. Its IUPAC name is 1-N-[2-[bis(4-fluorophenyl)methyl]-4,6-dimethylphenyl]-2-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N-[2-[bis(4-fluorophenyl)methyl]-4,6-dimethylphenyl]-2-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 122229833 |
| Molecular Formula | C43H36F2N2 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 1-N-[2-[bis(4-fluorophenyl)methyl]-4,6-dimethylphenyl]-2-N-(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | CCc1cccc(CC)c1/N=C1C(=N/c2c(C)cc(C)cc2C(c2ccc(F)cc2)c2ccc(F)cc2)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C43H36F2N2/c1-5-28-10-7-11-29(6-2)41(28)47-43-36-15-9-13-30-12-8-14-35(39(30)36)42(43)46-40-27(4)24-26(3)25-37(40)38(31-16-20-33(44)21-17-31)32-18-22-34(45)23-19-32/h7-25,38H,5-6H2,1-4H3/b46-42+,47-43+ |
| InChIKey | AJMRTVAHDWXLRG-JPFAOKFLSA-N |
| XLogP | 11.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|