C32H32Br2N2Ni — CID 18736437
1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine;dibromonickel (PubChem CID 18736437) has the molecular formula C32H32Br2N2Ni and a molecular weight of 663.12 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine;dibromonickel.
| Compound Name | 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine;dibromonickel |
|---|---|
| PubChem CID | 18736437 |
| Molecular Formula | C32H32Br2N2Ni |
| Molecular Weight | 663.12 g/mol |
| Exact Mass | 660.03 |
| IUPAC Name | 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine;dibromonickel |
| SMILES | Br[Ni]Br.CCc1cccc(CC)c1/N=C1C(=N/c2c(CC)cccc2CC)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C32H32N2.2BrH.Ni/c1-5-21-13-9-14-22(6-2)29(21)33-31-26-19-11-17-25-18-12-20-27(28(25)26)32(31)34-30-23(7-3)15-10-16-24(30)8-4;;;/h9-20H,5-8H2,1-4H3;2*1H;/q;;;+2/p-2/b33-31+,34-32+;;; |
| InChIKey | VRQBEHIOWWUNIZ-STMNGTSKSA-L |
| XLogP | 10.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.12 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|