C56H48Br2N2Ni — CID 139240965
1-N,2-N-bis(4-butyl-2,6-diphenylphenyl)acenaphthylene-1,2-diimine;dibromonickel (PubChem CID 139240965) has the molecular formula C56H48Br2N2Ni and a molecular weight of 967.52 g/mol. Its IUPAC name is 1-N,2-N-bis(4-butyl-2,6-diphenylphenyl)acenaphthylene-1,2-diimine;dibromonickel.
| Compound Name | 1-N,2-N-bis(4-butyl-2,6-diphenylphenyl)acenaphthylene-1,2-diimine;dibromonickel |
|---|---|
| PubChem CID | 139240965 |
| Molecular Formula | C56H48Br2N2Ni |
| Molecular Weight | 967.52 g/mol |
| Exact Mass | 964.15 |
| IUPAC Name | 1-N,2-N-bis(4-butyl-2,6-diphenylphenyl)acenaphthylene-1,2-diimine;dibromonickel |
| SMILES | Br[Ni]Br.CCCCc1cc(-c2ccccc2)c(/N=C2C(=N/c3c(-c4ccccc4)cc(CCCC)cc3-c3ccccc3)/c3cccc4cccc/2c34)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C56H48N2.2BrH.Ni/c1-3-5-21-39-35-48(41-23-11-7-12-24-41)53(49(36-39)42-25-13-8-14-26-42)57-55-46-33-19-31-45-32-20-34-47(52(45)46)56(55)58-54-50(43-27-15-9-16-28-43)37-40(22-6-4-2)38-51(54)44-29-17-10-18-30-44;;;/h7-20,23-38H,3-6,21-22H2,1-2H3;2*1H;/q;;;+2/p-2/b57-55+,58-56+;;; |
| InChIKey | SXZOUPCUGHLDHB-HXZYNKONSA-L |
| XLogP | 17.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.52 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|