C26H14F6N2 — CID 10930458
1-N,2-N-bis[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine (PubChem CID 10930458) has the molecular formula C26H14F6N2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 1-N,2-N-bis[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 10930458 |
| Molecular Formula | C26H14F6N2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-N,2-N-bis[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine |
| SMILES | FC(F)(F)c1ccc(/N=C2C(=N\c3ccc(C(F)(F)F)cc3)\c3cccc4cccc\2c34)cc1 |
| InChI | InChI=1S/C26H14F6N2/c27-25(28,29)16-7-11-18(12-8-16)33-23-20-5-1-3-15-4-2-6-21(22(15)20)24(23)34-19-13-9-17(10-14-19)26(30,31)32/h1-14H/b33-23-,34-24+ |
| InChIKey | ACGAFGGWTSOXFC-HUMGCQOQSA-N |
| XLogP | 8.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|