C25H19N2Ni- — CID 59475428
carbanide;1-N,2-N-diphenylacenaphthylene-1,2-diimine;nickel (PubChem CID 59475428) has the molecular formula C25H19N2Ni- and a molecular weight of 406.13 g/mol. Its IUPAC name is carbanide;1-N,2-N-diphenylacenaphthylene-1,2-diimine;nickel.
| Compound Name | carbanide;1-N,2-N-diphenylacenaphthylene-1,2-diimine;nickel |
|---|---|
| PubChem CID | 59475428 |
| Molecular Formula | C25H19N2Ni- |
| Molecular Weight | 406.13 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | carbanide;1-N,2-N-diphenylacenaphthylene-1,2-diimine;nickel |
| SMILES | [CH3-].[Ni].c1ccc(/N=C2C(=N\c3ccccc3)\c3cccc4cccc\2c34)cc1 |
| InChI | InChI=1S/C24H16N2.CH3.Ni/c1-3-11-18(12-4-1)25-23-20-15-7-9-17-10-8-16-21(22(17)20)24(23)26-19-13-5-2-6-14-19;;/h1-16H;1H3;/q;-1;/b25-23-,26-24+;; |
| InChIKey | ANZJQUNOMYWTSN-NHBWHGFPSA-N |
| XLogP | 6.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.13 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|