C31H31N2Ni- — CID 20789314
1-N,2-N-bis(2-ethyl-6-methylphenyl)acenaphthylene-1,2-diimine;carbanide;nickel (PubChem CID 20789314) has the molecular formula C31H31N2Ni- and a molecular weight of 490.30 g/mol. Its IUPAC name is 1-N,2-N-bis(2-ethyl-6-methylphenyl)acenaphthylene-1,2-diimine;carbanide;nickel.
| Compound Name | 1-N,2-N-bis(2-ethyl-6-methylphenyl)acenaphthylene-1,2-diimine;carbanide;nickel |
|---|---|
| PubChem CID | 20789314 |
| Molecular Formula | C31H31N2Ni- |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-N,2-N-bis(2-ethyl-6-methylphenyl)acenaphthylene-1,2-diimine;carbanide;nickel |
| SMILES | CCc1cccc(C)c1/N=C1C(=N/c2c(C)cccc2CC)/c2cccc3cccc/1c23.[CH3-].[Ni] |
| InChI | InChI=1S/C30H28N2.CH3.Ni/c1-5-21-13-7-11-19(3)27(21)31-29-24-17-9-15-23-16-10-18-25(26(23)24)30(29)32-28-20(4)12-8-14-22(28)6-2;;/h7-18H,5-6H2,1-4H3;1H3;/q;-1;/b31-29+,32-30+;; |
| InChIKey | KGQLEKFVPMEWDF-FBYWTXOISA-N |
| XLogP | 8.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|