C26H27N3O — CID 58722068
2-N-(2,6-dimethylphenyl)-1-N-(2-morpholin-4-ylethyl)acenaphthylene-1,2-diimine (PubChem CID 58722068) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-N-(2,6-dimethylphenyl)-1-N-(2-morpholin-4-ylethyl)acenaphthylene-1,2-diimine.
| Compound Name | 2-N-(2,6-dimethylphenyl)-1-N-(2-morpholin-4-ylethyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 58722068 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-N-(2,6-dimethylphenyl)-1-N-(2-morpholin-4-ylethyl)acenaphthylene-1,2-diimine |
| SMILES | Cc1cccc(C)c1/N=C1C(=N/CCN2CCOCC2)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C26H27N3O/c1-18-6-3-7-19(2)24(18)28-26-22-11-5-9-20-8-4-10-21(23(20)22)25(26)27-12-13-29-14-16-30-17-15-29/h3-11H,12-17H2,1-2H3/b27-25+,28-26+ |
| InChIKey | MDMWUFUANAZZDC-NBHCHVEOSA-N |
| XLogP | 4.71 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|