C16H17ClN2O3 — CID 6928252
2-chloro-3-(2-morpholin-4-ylethylimino)naphthalene-1,4-dione (PubChem CID 6928252) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-chloro-3-(2-morpholin-4-ylethylimino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(2-morpholin-4-ylethylimino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6928252 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-chloro-3-(2-morpholin-4-ylethylimino)naphthalene-1,4-dione |
| SMILES | O=C1/C(=N/CCN2CCOCC2)C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H17ClN2O3/c17-13-14(18-5-6-19-7-9-22-10-8-19)16(21)12-4-2-1-3-11(12)15(13)20/h1-4,13H,5-10H2/b18-14+ |
| InChIKey | ODBYAVPCQKJIAQ-NBVRZTHBSA-N |
| XLogP | 1.45 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|