C20H26N4O2 — CID 143450757
(4Z)-6-methyl-1-methylidene-3-(2-morpholin-4-ylethylimino)-6,7-dihydro-2,7-benzodiazecin-8-one (PubChem CID 143450757) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (4Z)-6-methyl-1-methylidene-3-(2-morpholin-4-ylethylimino)-6,7-dihydro-2,7-benzodiazecin-8-one.
| Compound Name | (4Z)-6-methyl-1-methylidene-3-(2-morpholin-4-ylethylimino)-6,7-dihydro-2,7-benzodiazecin-8-one |
|---|---|
| PubChem CID | 143450757 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (4Z)-6-methyl-1-methylidene-3-(2-morpholin-4-ylethylimino)-6,7-dihydro-2,7-benzodiazecin-8-one |
| SMILES | C=C1NC(=N/CCN2CCOCC2)/C=C\C(C)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C20H26N4O2/c1-15-7-8-19(21-9-10-24-11-13-26-14-12-24)23-16(2)17-5-3-4-6-18(17)20(25)22-15/h3-8,15H,2,9-14H2,1H3,(H,21,23)(H,22,25)/b8-7- |
| InChIKey | WKOJDUTZMWVSBQ-FPLPWBNLSA-N |
| XLogP | 1.67 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|