C19H21Cl2N3O4 — CID 67916555
2-hydroxy-1-(2-morpholin-4-ylethylimino)benzo[g]isoquinoline-5,10-dione;dihydrochloride (PubChem CID 67916555) has the molecular formula C19H21Cl2N3O4 and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-hydroxy-1-(2-morpholin-4-ylethylimino)benzo[g]isoquinoline-5,10-dione;dihydrochloride.
| Compound Name | 2-hydroxy-1-(2-morpholin-4-ylethylimino)benzo[g]isoquinoline-5,10-dione;dihydrochloride |
|---|---|
| PubChem CID | 67916555 |
| Molecular Formula | C19H21Cl2N3O4 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-hydroxy-1-(2-morpholin-4-ylethylimino)benzo[g]isoquinoline-5,10-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1c2ccccc2C(=O)c2c1ccn(O)/c2=N\CCN1CCOCC1 |
| InChI | InChI=1S/C19H19N3O4.2ClH/c23-17-13-3-1-2-4-14(13)18(24)16-15(17)5-7-22(25)19(16)20-6-8-21-9-11-26-12-10-21;;/h1-5,7,25H,6,8-12H2;2*1H/b20-19-;; |
| InChIKey | HCYNCSYYRNZCPX-YSRXXYTISA-N |
| XLogP | 1.58 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|