C23H27FN2O3 — CID 144958240
ethane;1-fluoro-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione (PubChem CID 144958240) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is ethane;1-fluoro-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione.
| Compound Name | ethane;1-fluoro-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 144958240 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethane;1-fluoro-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione |
| SMILES | CC.O=C1c2ccccc2C(=O)c2c(NCCCN3CCOCC3)ccc(F)c21 |
| InChI | InChI=1S/C21H21FN2O3.C2H6/c22-16-6-7-17(23-8-3-9-24-10-12-27-13-11-24)19-18(16)20(25)14-4-1-2-5-15(14)21(19)26;1-2/h1-2,4-7,23H,3,8-13H2;1-2H3 |
| InChIKey | NHZJXIRYXJUREJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|