C20H20N2O3 — CID 3959118
1-(2-morpholin-4-ylethylamino)anthracene-9,10-dione (PubChem CID 3959118) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethylamino)anthracene-9,10-dione.
| Compound Name | 1-(2-morpholin-4-ylethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 3959118 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-(2-morpholin-4-ylethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCN3CCOCC3)cccc21 |
| InChI | InChI=1S/C20H20N2O3/c23-19-14-4-1-2-5-15(14)20(24)18-16(19)6-3-7-17(18)21-8-9-22-10-12-25-13-11-22/h1-7,21H,8-13H2 |
| InChIKey | PMSJQWSSPGQEJD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|