C17H22N4O4 — CID 143627645
N-(3-amino-1,4-dioxo-2,3-dihydronaphthalen-2-yl)-N-(3-morpholin-4-ylpropyl)nitrous amide (PubChem CID 143627645) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3-amino-1,4-dioxo-2,3-dihydronaphthalen-2-yl)-N-(3-morpholin-4-ylpropyl)nitrous amide.
| Compound Name | N-(3-amino-1,4-dioxo-2,3-dihydronaphthalen-2-yl)-N-(3-morpholin-4-ylpropyl)nitrous amide |
|---|---|
| PubChem CID | 143627645 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(3-amino-1,4-dioxo-2,3-dihydronaphthalen-2-yl)-N-(3-morpholin-4-ylpropyl)nitrous amide |
| SMILES | NC1C(=O)c2ccccc2C(=O)C1N(CCCN1CCOCC1)N=O |
| InChI | InChI=1S/C17H22N4O4/c18-14-15(17(23)13-5-2-1-4-12(13)16(14)22)21(19-24)7-3-6-20-8-10-25-11-9-20/h1-2,4-5,14-15H,3,6-11,18H2 |
| InChIKey | LLNMHHQIYGVLBO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|