C21H25N3O2 — CID 7194317
(2R)-3-(3-morpholin-4-ylpropyl)-2-phenyl-1,2-dihydroquinazolin-4-one (PubChem CID 7194317) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2R)-3-(3-morpholin-4-ylpropyl)-2-phenyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(3-morpholin-4-ylpropyl)-2-phenyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 7194317 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2R)-3-(3-morpholin-4-ylpropyl)-2-phenyl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2ccccc2)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C21H25N3O2/c25-21-18-9-4-5-10-19(18)22-20(17-7-2-1-3-8-17)24(21)12-6-11-23-13-15-26-16-14-23/h1-5,7-10,20,22H,6,11-16H2/t20-/m1/s1 |
| InChIKey | UNZPCPMABZGFOA-HXUWFJFHSA-N |
| XLogP | 2.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |