C23H31N4O2+ — CID 7195061
(2S)-2-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ium-4-ylpropyl)-1,2-dihydroquinazolin-4-one (PubChem CID 7195061) has the molecular formula C23H31N4O2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ium-4-ylpropyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ium-4-ylpropyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 7195061 |
| Molecular Formula | C23H31N4O2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (2S)-2-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ium-4-ylpropyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CN(C)c1ccc([C@H]2Nc3ccccc3C(=O)N2CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C23H30N4O2/c1-25(2)19-10-8-18(9-11-19)22-24-21-7-4-3-6-20(21)23(28)27(22)13-5-12-26-14-16-29-17-15-26/h3-4,6-11,22,24H,5,12-17H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | WKGXEPYBZJOOJN-QFIPXVFZSA-O |
| XLogP | 1.62 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|