C21H21N2O3+ — CID 102059681
[2-(morpholin-4-ylmethyl)-3,4-dioxonaphthalen-1-yl]-phenylazanium (PubChem CID 102059681) has the molecular formula C21H21N2O3+ and a molecular weight of 349.41 g/mol. Its IUPAC name is [2-(morpholin-4-ylmethyl)-3,4-dioxonaphthalen-1-yl]-phenylazanium.
| Compound Name | [2-(morpholin-4-ylmethyl)-3,4-dioxonaphthalen-1-yl]-phenylazanium |
|---|---|
| PubChem CID | 102059681 |
| Molecular Formula | C21H21N2O3+ |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-(morpholin-4-ylmethyl)-3,4-dioxonaphthalen-1-yl]-phenylazanium |
| SMILES | O=C1C(=O)c2ccccc2C([NH2+]c2ccccc2)=C1CN1CCOCC1 |
| InChI | InChI=1S/C21H20N2O3/c24-20-17-9-5-4-8-16(17)19(22-15-6-2-1-3-7-15)18(21(20)25)14-23-10-12-26-13-11-23/h1-9,22H,10-14H2/p+1 |
| InChIKey | DPWAXWGAWPEEEK-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|