C22H25NO4 — CID 11530739
3-methyl-4-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-anthracene-2,9,10-trione (PubChem CID 11530739) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-methyl-4-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-anthracene-2,9,10-trione.
| Compound Name | 3-methyl-4-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-anthracene-2,9,10-trione |
|---|---|
| PubChem CID | 11530739 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-methyl-4-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-anthracene-2,9,10-trione |
| SMILES | CC1C(=O)CC2=C(C(=O)c3ccccc3C2=O)C1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H25NO4/c1-14-15(7-4-8-23-9-11-27-12-10-23)20-18(13-19(14)24)21(25)16-5-2-3-6-17(16)22(20)26/h2-3,5-6,14-15H,4,7-13H2,1H3 |
| InChIKey | KURQAKMHRBSLAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|