C21H22N2O6 — CID 57117723
1-methoxy-N-(2-morpholin-4-ylethyl)-5,10-dioxo-1H-benzo[g]isochromene-3-carboxamide (PubChem CID 57117723) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1-methoxy-N-(2-morpholin-4-ylethyl)-5,10-dioxo-1H-benzo[g]isochromene-3-carboxamide.
| Compound Name | 1-methoxy-N-(2-morpholin-4-ylethyl)-5,10-dioxo-1H-benzo[g]isochromene-3-carboxamide |
|---|---|
| PubChem CID | 57117723 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-methoxy-N-(2-morpholin-4-ylethyl)-5,10-dioxo-1H-benzo[g]isochromene-3-carboxamide |
| SMILES | COC1OC(C(=O)NCCN2CCOCC2)=CC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H22N2O6/c1-27-21-17-15(18(24)13-4-2-3-5-14(13)19(17)25)12-16(29-21)20(26)22-6-7-23-8-10-28-11-9-23/h2-5,12,21H,6-11H2,1H3,(H,22,26) |
| InChIKey | MDHHQNIVJYQRDQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|