C20H20N2O5 — CID 175412482
3-methyl-N-(2-morpholin-4-ylethyl)-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide (PubChem CID 175412482) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-methyl-N-(2-morpholin-4-ylethyl)-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-(2-morpholin-4-ylethyl)-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 175412482 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-methyl-N-(2-morpholin-4-ylethyl)-4,5-dioxobenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCOCC2)oc2c1C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H20N2O5/c1-12-15-17(24)16(23)13-4-2-3-5-14(13)19(15)27-18(12)20(25)21-6-7-22-8-10-26-11-9-22/h2-5H,6-11H2,1H3,(H,21,25) |
| InChIKey | UYBPSMWBDHAEAL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|