C22H27FN4O5S — CID 19162944
(4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(2-morpholin-4-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19162944) has the molecular formula C22H27FN4O5S and a molecular weight of 478.55 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(2-morpholin-4-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(2-morpholin-4-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19162944 |
| Molecular Formula | C22H27FN4O5S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)sulfonylhydrazinylidene]-3-methyl-N-(2-morpholin-4-ylethyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCOCC2)oc2c1/C(=N/NS(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C22H27FN4O5S/c1-15-20-18(25-26-33(29,30)17-7-5-16(23)6-8-17)3-2-4-19(20)32-21(15)22(28)24-9-10-27-11-13-31-14-12-27/h5-8,26H,2-4,9-14H2,1H3,(H,24,28)/b25-18+ |
| InChIKey | OVPSOVMIQKXVGI-XIEYBQDHSA-N |
| XLogP | 1.81 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|