C24H29BrN4O4 — CID 19156900
(4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19156900) has the molecular formula C24H29BrN4O4 and a molecular weight of 517.42 g/mol. Its IUPAC name is (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19156900 |
| Molecular Formula | C24H29BrN4O4 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | (4E)-4-[(2-bromobenzoyl)hydrazinylidene]-3-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCOCC2)oc2c1/C(=N/NC(=O)c1ccccc1Br)CCC2 |
| InChI | InChI=1S/C24H29BrN4O4/c1-16-21-19(27-28-23(30)17-6-2-3-7-18(17)25)8-4-9-20(21)33-22(16)24(31)26-10-5-11-29-12-14-32-15-13-29/h2-3,6-7H,4-5,8-15H2,1H3,(H,26,31)(H,28,30)/b27-19+ |
| InChIKey | VQIPVJMYZUGURD-ZXVVBBHZSA-N |
| XLogP | 3.27 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|