C23H24ClN5O3 — CID 19156742
(4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-N-(3-imidazol-1-ylpropyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19156742) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-N-(3-imidazol-1-ylpropyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-N-(3-imidazol-1-ylpropyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19156742 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (4E)-4-[(2-chlorobenzoyl)hydrazinylidene]-N-(3-imidazol-1-ylpropyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCn2ccnc2)oc2c1/C(=N/NC(=O)c1ccccc1Cl)CCC2 |
| InChI | InChI=1S/C23H24ClN5O3/c1-15-20-18(27-28-22(30)16-6-2-3-7-17(16)24)8-4-9-19(20)32-21(15)23(31)26-10-5-12-29-13-11-25-14-29/h2-3,6-7,11,13-14H,4-5,8-10,12H2,1H3,(H,26,31)(H,28,30)/b27-18+ |
| InChIKey | IEODTSJHKXPGER-OVVQPSECSA-N |
| XLogP | 3.73 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|