C11H16N2S — CID 45094873
methyl N'-(2-ethyl-6-methylphenyl)carbamimidothioate (PubChem CID 45094873) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is methyl N'-(2-ethyl-6-methylphenyl)carbamimidothioate.
| Compound Name | methyl N'-(2-ethyl-6-methylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 45094873 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | methyl N'-(2-ethyl-6-methylphenyl)carbamimidothioate |
| SMILES | CCc1cccc(C)c1/N=C(/N)SC |
| InChI | InChI=1S/C11H16N2S/c1-4-9-7-5-6-8(2)10(9)13-11(12)14-3/h5-7H,4H2,1-3H3,(H2,12,13) |
| InChIKey | GLEXJTNUEKNXNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|