C24H26N2O — CID 22968266
N-(2-ethyl-6-methylphenyl)-1-[5-[(2-ethyl-6-methylphenyl)iminomethyl]furan-2-yl]methanimine (PubChem CID 22968266) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-1-[5-[(2-ethyl-6-methylphenyl)iminomethyl]furan-2-yl]methanimine.
| Compound Name | N-(2-ethyl-6-methylphenyl)-1-[5-[(2-ethyl-6-methylphenyl)iminomethyl]furan-2-yl]methanimine |
|---|---|
| PubChem CID | 22968266 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-1-[5-[(2-ethyl-6-methylphenyl)iminomethyl]furan-2-yl]methanimine |
| SMILES | CCc1cccc(C)c1/N=C/c1ccc(/C=N/c2c(C)cccc2CC)o1 |
| InChI | InChI=1S/C24H26N2O/c1-5-19-11-7-9-17(3)23(19)25-15-21-13-14-22(27-21)16-26-24-18(4)10-8-12-20(24)6-2/h7-16H,5-6H2,1-4H3/b25-15+,26-16+ |
| InChIKey | YUERENXBGKKWAS-RYQLWAFASA-N |
| XLogP | 6.52 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|