C18H8Cl6N2O — CID 20701872
N-(2,4,6-trichlorophenyl)-1-[5-[(2,4,6-trichlorophenyl)iminomethyl]furan-2-yl]methanimine (PubChem CID 20701872) has the molecular formula C18H8Cl6N2O and a molecular weight of 480.99 g/mol. Its IUPAC name is N-(2,4,6-trichlorophenyl)-1-[5-[(2,4,6-trichlorophenyl)iminomethyl]furan-2-yl]methanimine.
| Compound Name | N-(2,4,6-trichlorophenyl)-1-[5-[(2,4,6-trichlorophenyl)iminomethyl]furan-2-yl]methanimine |
|---|---|
| PubChem CID | 20701872 |
| Molecular Formula | C18H8Cl6N2O |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 477.88 |
| IUPAC Name | N-(2,4,6-trichlorophenyl)-1-[5-[(2,4,6-trichlorophenyl)iminomethyl]furan-2-yl]methanimine |
| SMILES | Clc1cc(Cl)c(/N=C/c2ccc(/C=N/c3c(Cl)cc(Cl)cc3Cl)o2)c(Cl)c1 |
| InChI | InChI=1S/C18H8Cl6N2O/c19-9-3-13(21)17(14(22)4-9)25-7-11-1-2-12(27-11)8-26-18-15(23)5-10(20)6-16(18)24/h1-8H/b25-7+,26-8+ |
| InChIKey | YABRNCFRECZGEC-CFMYDQSQSA-N |
| XLogP | 8.70 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|