C16H15N3O — CID 20701846
[5-[(2,4,6-trimethylphenyl)iminomethyl]furan-2-yl]methylidenecyanamide (PubChem CID 20701846) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is [5-[(2,4,6-trimethylphenyl)iminomethyl]furan-2-yl]methylidenecyanamide.
| Compound Name | [5-[(2,4,6-trimethylphenyl)iminomethyl]furan-2-yl]methylidenecyanamide |
|---|---|
| PubChem CID | 20701846 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [5-[(2,4,6-trimethylphenyl)iminomethyl]furan-2-yl]methylidenecyanamide |
| SMILES | Cc1cc(C)c(/N=C/c2ccc(/C=N/C#N)o2)c(C)c1 |
| InChI | InChI=1S/C16H15N3O/c1-11-6-12(2)16(13(3)7-11)19-9-15-5-4-14(20-15)8-18-10-17/h4-9H,1-3H3/b18-8+,19-9+ |
| InChIKey | KUAZBFSDWKBYSA-GCBPPVMSSA-N |
| XLogP | 3.86 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|