C25H29Br2FeN3 — CID 18718659
dibromoiron;1-[1-methyl-5-[(2,4,6-trimethylphenyl)iminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 18718659) has the molecular formula C25H29Br2FeN3 and a molecular weight of 587.18 g/mol. Its IUPAC name is dibromoiron;1-[1-methyl-5-[(2,4,6-trimethylphenyl)iminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | dibromoiron;1-[1-methyl-5-[(2,4,6-trimethylphenyl)iminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 18718659 |
| Molecular Formula | C25H29Br2FeN3 |
| Molecular Weight | 587.18 g/mol |
| Exact Mass | 585.01 |
| IUPAC Name | dibromoiron;1-[1-methyl-5-[(2,4,6-trimethylphenyl)iminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Br[Fe]Br.Cc1cc(C)c(/N=C/c2ccc(/C=N/c3c(C)cc(C)cc3C)n2C)c(C)c1 |
| InChI | InChI=1S/C25H29N3.2BrH.Fe/c1-16-10-18(3)24(19(4)11-16)26-14-22-8-9-23(28(22)7)15-27-25-20(5)12-17(2)13-21(25)6;;;/h8-15H,1-7H3;2*1H;/q;;;+2/p-2/b26-14+,27-15+;;; |
| InChIKey | GIAVEBDXFHFFEK-RYSUYRDUSA-L |
| XLogP | 8.07 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.18 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|