C16H15Br2NO — CID 2781419
2,6-dibromo-4-[(2,4,6-trimethylphenyl)iminomethyl]phenol (PubChem CID 2781419) has the molecular formula C16H15Br2NO and a molecular weight of 397.11 g/mol. Its IUPAC name is 2,6-dibromo-4-[(2,4,6-trimethylphenyl)iminomethyl]phenol.
| Compound Name | 2,6-dibromo-4-[(2,4,6-trimethylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 2781419 |
| Molecular Formula | C16H15Br2NO |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 2,6-dibromo-4-[(2,4,6-trimethylphenyl)iminomethyl]phenol |
| SMILES | Cc1cc(C)c(/N=C/c2cc(Br)c(O)c(Br)c2)c(C)c1 |
| InChI | InChI=1S/C16H15Br2NO/c1-9-4-10(2)15(11(3)5-9)19-8-12-6-13(17)16(20)14(18)7-12/h4-8,20H,1-3H3/b19-8+ |
| InChIKey | ZVVPXFJLJMYWCZ-UFWORHAWSA-N |
| XLogP | 5.59 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|