About 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol
5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol (PubChem CID 135949185) has the molecular formula C18H16BrClN2O
and a molecular weight of 391.70 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol |
| PubChem CID | 135949185 |
| Molecular Formula | C18H16BrClN2O |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol |
| SMILES | Cc1cc(C)c(/N=C/c2[nH]c3ccc(Br)c(Cl)c3c2O)c(C)c1 |
| InChI | InChI=1S/C18H16BrClN2O/c1-9-6-10(2)17(11(3)7-9)21-8-14-18(23)15-13(22-14)5-4-12(19)16(15)20/h4-8,22-23H,1-3H3/b21-8+ |
| InChIKey | NINWFHBYIPGEHK-ODCIPOBUSA-N |
| XLogP | 5.97 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol?
The IUPAC name of 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol (CID 135949185) is 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol.
What is the SMILES notation for 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol?
The canonical SMILES for 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol is Cc1cc(C)c(/N=C/c2[nH]c3ccc(Br)c(Cl)c3c2O)c(C)c1.
What is the InChIKey of 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol?
The InChIKey is NINWFHBYIPGEHK-ODCIPOBUSA-N. The full InChI is InChI=1S/C18H16BrClN2O/c1-9-6-10(2)17(11(3)7-9)21-8-14-18(23)15-13(22-14)5-4-12(19)16(15)20/h4-8,22-23H,1-3H3/b21-8+.
What are the key properties of 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol?
5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol has a molecular weight of 391.70 g/mol, XLogP of 5.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-2-[(2,4,6-trimethylphenyl)iminomethyl]-1H-indol-3-ol is sourced from PubChem (CID 135949185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).