C34H33N3Si — CID 18718686
(E)-1-[1-methyl-5-[(E)-triphenylsilyliminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 18718686) has the molecular formula C34H33N3Si and a molecular weight of 511.75 g/mol. Its IUPAC name is (E)-1-[1-methyl-5-[(E)-triphenylsilyliminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | (E)-1-[1-methyl-5-[(E)-triphenylsilyliminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 18718686 |
| Molecular Formula | C34H33N3Si |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (E)-1-[1-methyl-5-[(E)-triphenylsilyliminomethyl]pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/N=C/c2ccc(/C=N/[Si](c3ccccc3)(c3ccccc3)c3ccccc3)n2C)c(C)c1 |
| InChI | InChI=1S/C34H33N3Si/c1-26-22-27(2)34(28(3)23-26)35-24-29-20-21-30(37(29)4)25-36-38(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-25H,1-4H3/b35-24+,36-25+ |
| InChIKey | XUELPJNCPDJOKS-YKTJOGQJSA-N |
| XLogP | 5.79 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|