C35H35N3Si — CID 158184309
1-[5-(C-methyl-N-triphenylsilylcarbonimidoyl)-1H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 158184309) has the molecular formula C35H35N3Si and a molecular weight of 525.77 g/mol. Its IUPAC name is 1-[5-(C-methyl-N-triphenylsilylcarbonimidoyl)-1H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | 1-[5-(C-methyl-N-triphenylsilylcarbonimidoyl)-1H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 158184309 |
| Molecular Formula | C35H35N3Si |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-[5-(C-methyl-N-triphenylsilylcarbonimidoyl)-1H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | CC(=N[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(/C(C)=N/c2c(C)cc(C)cc2C)[nH]1 |
| InChI | InChI=1S/C35H35N3Si/c1-25-23-26(2)35(27(3)24-25)36-28(4)33-21-22-34(37-33)29(5)38-39(30-15-9-6-10-16-30,31-17-11-7-12-18-31)32-19-13-8-14-20-32/h6-24,37H,1-5H3/b36-28+,38-29? |
| InChIKey | OZWOXUYSYQPJMR-KCIBXXOBSA-N |
| XLogP | 6.56 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|