C45H41N3Si2 — CID 18718784
(E)-1-[1-methyl-5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]pyrrol-2-yl]-N-triphenylsilylethanimine (PubChem CID 18718784) has the molecular formula C45H41N3Si2 and a molecular weight of 680.02 g/mol. Its IUPAC name is (E)-1-[1-methyl-5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]pyrrol-2-yl]-N-triphenylsilylethanimine.
| Compound Name | (E)-1-[1-methyl-5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]pyrrol-2-yl]-N-triphenylsilylethanimine |
|---|---|
| PubChem CID | 18718784 |
| Molecular Formula | C45H41N3Si2 |
| Molecular Weight | 680.02 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | (E)-1-[1-methyl-5-[(E)-C-methyl-N-triphenylsilylcarbonimidoyl]pyrrol-2-yl]-N-triphenylsilylethanimine |
| SMILES | C/C(=N\[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(/C(C)=N/[Si](c2ccccc2)(c2ccccc2)c2ccccc2)n1C |
| InChI | InChI=1S/C45H41N3Si2/c1-36(46-49(38-22-10-4-11-23-38,39-24-12-5-13-25-39)40-26-14-6-15-27-40)44-34-35-45(48(44)3)37(2)47-50(41-28-16-7-17-29-41,42-30-18-8-19-31-42)43-32-20-9-21-33-43/h4-35H,1-3H3/b46-36+,47-37+ |
| InChIKey | LKHNGGKGCPFYFS-MWSRKQDVSA-N |
| XLogP | 5.98 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.02 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|