C30H26N2NiO2 — CID 161248104
nickel(2+);phenanthrene-9,10-diolate;1-pyridin-2-yl-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 161248104) has the molecular formula C30H26N2NiO2 and a molecular weight of 505.24 g/mol. Its IUPAC name is nickel(2+);phenanthrene-9,10-diolate;1-pyridin-2-yl-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | nickel(2+);phenanthrene-9,10-diolate;1-pyridin-2-yl-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 161248104 |
| Molecular Formula | C30H26N2NiO2 |
| Molecular Weight | 505.24 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | nickel(2+);phenanthrene-9,10-diolate;1-pyridin-2-yl-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1ccccn1.[Ni+2].[O-]c1c([O-])c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C16H18N2.C14H10O2.Ni/c1-11-9-12(2)16(13(3)10-11)18-14(4)15-7-5-6-8-17-15;15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16;/h5-10H,1-4H3;1-8,15-16H;/q;;+2/p-2/b18-14+;; |
| InChIKey | VAXCNRLHECRVDU-RAIISBKQSA-L |
| XLogP | 6.29 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.24 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|