C90H84N6 — CID 139193639
N-[4-[4-(benzylideneamino)-3,5-dimethylphenyl]-2,6-dimethylphenyl]-1-phenylmethanimine (PubChem CID 139193639) has the molecular formula C90H84N6 and a molecular weight of 1249.70 g/mol. Its IUPAC name is N-[4-[4-(benzylideneamino)-3,5-dimethylphenyl]-2,6-dimethylphenyl]-1-phenylmethanimine.
| Compound Name | N-[4-[4-(benzylideneamino)-3,5-dimethylphenyl]-2,6-dimethylphenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 139193639 |
| Molecular Formula | C90H84N6 |
| Molecular Weight | 1249.70 g/mol |
| Exact Mass | 1248.68 |
| IUPAC Name | N-[4-[4-(benzylideneamino)-3,5-dimethylphenyl]-2,6-dimethylphenyl]-1-phenylmethanimine |
| SMILES | Cc1cc(-c2cc(C)c(/N=C/c3ccccc3)c(C)c2)cc(C)c1/N=C/c1ccccc1.Cc1cc(-c2cc(C)c(/N=C/c3ccccc3)c(C)c2)cc(C)c1/N=C/c1ccccc1.Cc1cc(-c2cc(C)c(/N=C/c3ccccc3)c(C)c2)cc(C)c1/N=C/c1ccccc1 |
| InChI | InChI=1S/3C30H28N2/c3*1-21-15-27(16-22(2)29(21)31-19-25-11-7-5-8-12-25)28-17-23(3)30(24(4)18-28)32-20-26-13-9-6-10-14-26/h3*5-20H,1-4H3/b3*31-19+,32-20+ |
| InChIKey | GBYUHAJQSKFTFW-CMDWGPAWSA-N |
| XLogP | 24.27 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1249.70 |
| LogP ≤ 5 | 24.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|