C25H28NP — CID 132595705
2-diphenylphosphanyl-2-methyl-N-(2,4,6-trimethylphenyl)propan-1-imine (PubChem CID 132595705) has the molecular formula C25H28NP and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-diphenylphosphanyl-2-methyl-N-(2,4,6-trimethylphenyl)propan-1-imine.
| Compound Name | 2-diphenylphosphanyl-2-methyl-N-(2,4,6-trimethylphenyl)propan-1-imine |
|---|---|
| PubChem CID | 132595705 |
| Molecular Formula | C25H28NP |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-diphenylphosphanyl-2-methyl-N-(2,4,6-trimethylphenyl)propan-1-imine |
| SMILES | Cc1cc(C)c(/N=C/C(C)(C)P(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H28NP/c1-19-16-20(2)24(21(3)17-19)26-18-25(4,5)27(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-18H,1-5H3/b26-18+ |
| InChIKey | GXNJAZYAUKBCPR-NLRVBDNBSA-N |
| XLogP | 6.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|