C17H25N — CID 102080262
2,2,4-trimethyl-N-(2,4,6-trimethylphenyl)pent-4-en-1-imine (PubChem CID 102080262) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2,2,4-trimethyl-N-(2,4,6-trimethylphenyl)pent-4-en-1-imine.
| Compound Name | 2,2,4-trimethyl-N-(2,4,6-trimethylphenyl)pent-4-en-1-imine |
|---|---|
| PubChem CID | 102080262 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2,2,4-trimethyl-N-(2,4,6-trimethylphenyl)pent-4-en-1-imine |
| SMILES | C=C(C)CC(C)(C)/C=N/c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H25N/c1-12(2)10-17(6,7)11-18-16-14(4)8-13(3)9-15(16)5/h8-9,11H,1,10H2,2-7H3/b18-11+ |
| InChIKey | BSKQAEYGTXFSME-WOJGMQOQSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|