C17H28NP — CID 158160555
2-di(propan-2-yl)phosphanyl-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 158160555) has the molecular formula C17H28NP and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphanyl-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | 2-di(propan-2-yl)phosphanyl-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 158160555 |
| Molecular Formula | C17H28NP |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-di(propan-2-yl)phosphanyl-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | Cc1cc(C)c(/N=C/CP(C(C)C)C(C)C)c(C)c1 |
| InChI | InChI=1S/C17H28NP/c1-12(2)19(13(3)4)9-8-18-17-15(6)10-14(5)11-16(17)7/h8,10-13H,9H2,1-7H3/b18-8+ |
| InChIKey | SGOMBBKTNKHZKU-QGMBQPNBSA-N |
| XLogP | 5.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|