C19H24N2 — CID 3355627
N,N'-bis(2,4,6-trimethylphenyl)methanimidamide (PubChem CID 3355627) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N,N'-bis(2,4,6-trimethylphenyl)methanimidamide.
| Compound Name | N,N'-bis(2,4,6-trimethylphenyl)methanimidamide |
|---|---|
| PubChem CID | 3355627 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N,N'-bis(2,4,6-trimethylphenyl)methanimidamide |
| SMILES | Cc1cc(C)c(/N=C/Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C19H24N2/c1-12-7-14(3)18(15(4)8-12)20-11-21-19-16(5)9-13(2)10-17(19)6/h7-11H,1-6H3,(H,20,21) |
| InChIKey | VSPPKNZKMVKGNX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|