C27H32N2 — CID 102233821
3,5-dimethyl-N,N'-bis(2,4,6-trimethylphenyl)benzenecarboximidamide (PubChem CID 102233821) has the molecular formula C27H32N2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 3,5-dimethyl-N,N'-bis(2,4,6-trimethylphenyl)benzenecarboximidamide.
| Compound Name | 3,5-dimethyl-N,N'-bis(2,4,6-trimethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102233821 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 3,5-dimethyl-N,N'-bis(2,4,6-trimethylphenyl)benzenecarboximidamide |
| SMILES | Cc1cc(C)cc(/C(=N\c2c(C)cc(C)cc2C)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C27H32N2/c1-16-9-17(2)15-24(14-16)27(28-25-20(5)10-18(3)11-21(25)6)29-26-22(7)12-19(4)13-23(26)8/h9-15H,1-8H3,(H,28,29) |
| InChIKey | OLVHZDXARHTCBS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|