C27H28N2 — CID 20660785
3-phenyl-N,N'-bis(2,4,6-trimethylphenyl)prop-2-ynimidamide (PubChem CID 20660785) has the molecular formula C27H28N2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 3-phenyl-N,N'-bis(2,4,6-trimethylphenyl)prop-2-ynimidamide.
| Compound Name | 3-phenyl-N,N'-bis(2,4,6-trimethylphenyl)prop-2-ynimidamide |
|---|---|
| PubChem CID | 20660785 |
| Molecular Formula | C27H28N2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-phenyl-N,N'-bis(2,4,6-trimethylphenyl)prop-2-ynimidamide |
| SMILES | Cc1cc(C)c(/N=C(\C#Cc2ccccc2)Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H28N2/c1-18-14-20(3)26(21(4)15-18)28-25(13-12-24-10-8-7-9-11-24)29-27-22(5)16-19(2)17-23(27)6/h7-11,14-17H,1-6H3,(H,28,29) |
| InChIKey | ZCKIJXUACFTDDW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|