C18H19N — CID 177415515
N,2,4,6-tetramethyl-N-(2-phenylethynyl)aniline (PubChem CID 177415515) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is N,2,4,6-tetramethyl-N-(2-phenylethynyl)aniline.
| Compound Name | N,2,4,6-tetramethyl-N-(2-phenylethynyl)aniline |
|---|---|
| PubChem CID | 177415515 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N,2,4,6-tetramethyl-N-(2-phenylethynyl)aniline |
| SMILES | Cc1cc(C)c(N(C)C#Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H19N/c1-14-12-15(2)18(16(3)13-14)19(4)11-10-17-8-6-5-7-9-17/h5-9,12-13H,1-4H3 |
| InChIKey | ACRAFAQCGTUHJV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|