C27H24O2 — CID 2716465
(1R)-4-phenyl-2-(2-phenylethynyl)-1-(2,4,6-trimethylphenyl)but-3-yne-1,2-diol (PubChem CID 2716465) has the molecular formula C27H24O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (1R)-4-phenyl-2-(2-phenylethynyl)-1-(2,4,6-trimethylphenyl)but-3-yne-1,2-diol.
| Compound Name | (1R)-4-phenyl-2-(2-phenylethynyl)-1-(2,4,6-trimethylphenyl)but-3-yne-1,2-diol |
|---|---|
| PubChem CID | 2716465 |
| Molecular Formula | C27H24O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1R)-4-phenyl-2-(2-phenylethynyl)-1-(2,4,6-trimethylphenyl)but-3-yne-1,2-diol |
| SMILES | Cc1cc(C)c([C@@H](O)C(O)(C#Cc2ccccc2)C#Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H24O2/c1-20-18-21(2)25(22(3)19-20)26(28)27(29,16-14-23-10-6-4-7-11-23)17-15-24-12-8-5-9-13-24/h4-13,18-19,26,28-29H,1-3H3/t26-/m1/s1 |
| InChIKey | FSTLQOZBIPADHC-AREMUKBSSA-N |
| XLogP | 4.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|