C20H22O2 — CID 101126743
(1S,2S,3S)-3-ethyl-2-methyl-1,5-diphenylpent-4-yne-1,3-diol (PubChem CID 101126743) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1S,2S,3S)-3-ethyl-2-methyl-1,5-diphenylpent-4-yne-1,3-diol.
| Compound Name | (1S,2S,3S)-3-ethyl-2-methyl-1,5-diphenylpent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 101126743 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1S,2S,3S)-3-ethyl-2-methyl-1,5-diphenylpent-4-yne-1,3-diol |
| SMILES | CC[C@@](O)(C#Cc1ccccc1)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-3-20(22,15-14-17-10-6-4-7-11-17)16(2)19(21)18-12-8-5-9-13-18/h4-13,16,19,21-22H,3H2,1-2H3/t16-,19-,20+/m0/s1 |
| InChIKey | ACLUBLKMSWBKGI-FFZOFVMBSA-N |
| XLogP | 3.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|