C15H24O2 — CID 101126744
(1S,2S,3R)-3-ethyl-2,4-dimethyl-1-phenylpentane-1,3-diol (PubChem CID 101126744) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,2S,3R)-3-ethyl-2,4-dimethyl-1-phenylpentane-1,3-diol.
| Compound Name | (1S,2S,3R)-3-ethyl-2,4-dimethyl-1-phenylpentane-1,3-diol |
|---|---|
| PubChem CID | 101126744 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,2S,3R)-3-ethyl-2,4-dimethyl-1-phenylpentane-1,3-diol |
| SMILES | CC[C@@](O)(C(C)C)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H24O2/c1-5-15(17,11(2)3)12(4)14(16)13-9-7-6-8-10-13/h6-12,14,16-17H,5H2,1-4H3/t12-,14-,15+/m0/s1 |
| InChIKey | DCJPPVJQRPZFFZ-AEGPPILISA-N |
| XLogP | 3.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |