C19H24O2 — CID 11055205
(1R,2R,3S)-3-benzyl-2-methyl-1-phenylpentane-1,3-diol (PubChem CID 11055205) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (1R,2R,3S)-3-benzyl-2-methyl-1-phenylpentane-1,3-diol.
| Compound Name | (1R,2R,3S)-3-benzyl-2-methyl-1-phenylpentane-1,3-diol |
|---|---|
| PubChem CID | 11055205 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1R,2R,3S)-3-benzyl-2-methyl-1-phenylpentane-1,3-diol |
| SMILES | CC[C@](O)(Cc1ccccc1)[C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-3-19(21,14-16-10-6-4-7-11-16)15(2)18(20)17-12-8-5-9-13-17/h4-13,15,18,20-21H,3,14H2,1-2H3/t15-,18-,19+/m1/s1 |
| InChIKey | YJHKZWVTAARTFV-LZQZEXGQSA-N |
| XLogP | 3.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |